C7H8N4O7SV — CID 87299220
3,7-dimethylpurine-2,6-dione;oxovanadium(2+);sulfate (PubChem CID 87299220) has the molecular formula C7H8N4O7SV and a molecular weight of 343.17 g/mol. Its IUPAC name is 3,7-dimethylpurine-2,6-dione;oxovanadium(2+);sulfate.
| Compound Name | 3,7-dimethylpurine-2,6-dione;oxovanadium(2+);sulfate |
|---|---|
| PubChem CID | 87299220 |
| Molecular Formula | C7H8N4O7SV |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 3,7-dimethylpurine-2,6-dione;oxovanadium(2+);sulfate |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C.O=S(=O)([O-])[O-].O=[V+2] |
| InChI | InChI=1S/C7H8N4O2.H2O4S.O.V/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-5(2,3)4;;/h3H,1-2H3,(H,9,12,13);(H2,1,2,3,4);;/q;;;+2/p-2 |
| InChIKey | IRZAWJVCLPNIEC-UHFFFAOYSA-L |
| XLogP | -2.50 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|