C13H19N5O3 — CID 82465656
3-(3-methoxypropyl)-7-pyrrolidin-3-ylpurine-2,6-dione (PubChem CID 82465656) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-7-pyrrolidin-3-ylpurine-2,6-dione.
| Compound Name | 3-(3-methoxypropyl)-7-pyrrolidin-3-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82465656 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-(3-methoxypropyl)-7-pyrrolidin-3-ylpurine-2,6-dione |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c1ncn2C1CCNC1 |
| InChI | InChI=1S/C13H19N5O3/c1-21-6-2-5-17-11-10(12(19)16-13(17)20)18(8-15-11)9-3-4-14-7-9/h8-9,14H,2-7H2,1H3,(H,16,19,20) |
| InChIKey | NWJVJKJRDRQLMB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|