C12H20N6O3 — CID 82464328
8-(2-aminoethylamino)-3-(3-methoxypropyl)-7-methylpurine-2,6-dione (PubChem CID 82464328) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-3-(3-methoxypropyl)-7-methylpurine-2,6-dione.
| Compound Name | 8-(2-aminoethylamino)-3-(3-methoxypropyl)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464328 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 8-(2-aminoethylamino)-3-(3-methoxypropyl)-7-methylpurine-2,6-dione |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c1nc(NCCN)n2C |
| InChI | InChI=1S/C12H20N6O3/c1-17-8-9(15-11(17)14-5-4-13)18(6-3-7-21-2)12(20)16-10(8)19/h3-7,13H2,1-2H3,(H,14,15)(H,16,19,20) |
| InChIKey | MHJPFRXSFVIAIO-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|