C12H19N5O4 — CID 82465462
7-ethyl-8-(2-hydroxyethylamino)-3-(2-methoxyethyl)purine-2,6-dione (PubChem CID 82465462) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is 7-ethyl-8-(2-hydroxyethylamino)-3-(2-methoxyethyl)purine-2,6-dione.
| Compound Name | 7-ethyl-8-(2-hydroxyethylamino)-3-(2-methoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82465462 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 7-ethyl-8-(2-hydroxyethylamino)-3-(2-methoxyethyl)purine-2,6-dione |
| SMILES | CCn1c(NCCO)nc2c1c(=O)[nH]c(=O)n2CCOC |
| InChI | InChI=1S/C12H19N5O4/c1-3-16-8-9(14-11(16)13-4-6-18)17(5-7-21-2)12(20)15-10(8)19/h18H,3-7H2,1-2H3,(H,13,14)(H,15,19,20) |
| InChIKey | DCGNPLVRWSUCPN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |