C11H18N6O2 — CID 82464133
8-(2-aminoethylamino)-7-methyl-3-propylpurine-2,6-dione (PubChem CID 82464133) has the molecular formula C11H18N6O2 and a molecular weight of 266.31 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-7-methyl-3-propylpurine-2,6-dione.
| Compound Name | 8-(2-aminoethylamino)-7-methyl-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464133 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 8-(2-aminoethylamino)-7-methyl-3-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2c1nc(NCCN)n2C |
| InChI | InChI=1S/C11H18N6O2/c1-3-6-17-8-7(9(18)15-11(17)19)16(2)10(14-8)13-5-4-12/h3-6,12H2,1-2H3,(H,13,14)(H,15,18,19) |
| InChIKey | MNQQKTLLHHIRFZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |