C13H22N6O2 — CID 82464265
8-(3-aminopropylamino)-3-butan-2-yl-7-methylpurine-2,6-dione (PubChem CID 82464265) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 8-(3-aminopropylamino)-3-butan-2-yl-7-methylpurine-2,6-dione.
| Compound Name | 8-(3-aminopropylamino)-3-butan-2-yl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464265 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 8-(3-aminopropylamino)-3-butan-2-yl-7-methylpurine-2,6-dione |
| SMILES | CCC(C)n1c(=O)[nH]c(=O)c2c1nc(NCCCN)n2C |
| InChI | InChI=1S/C13H22N6O2/c1-4-8(2)19-10-9(11(20)17-13(19)21)18(3)12(16-10)15-7-5-6-14/h8H,4-7,14H2,1-3H3,(H,15,16)(H,17,20,21) |
| InChIKey | VFORTRRTISMLTM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|