C14H24N6O2 — CID 82463911
8-(3-aminopropylamino)-1,3-dimethyl-7-(2-methylpropyl)purine-2,6-dione (PubChem CID 82463911) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 8-(3-aminopropylamino)-1,3-dimethyl-7-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopropylamino)-1,3-dimethyl-7-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82463911 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 8-(3-aminopropylamino)-1,3-dimethyl-7-(2-methylpropyl)purine-2,6-dione |
| SMILES | CC(C)Cn1c(NCCCN)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H24N6O2/c1-9(2)8-20-10-11(17-13(20)16-7-5-6-15)18(3)14(22)19(4)12(10)21/h9H,5-8,15H2,1-4H3,(H,16,17) |
| InChIKey | YWZARGMEFJJVLW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|