C17H20N4O3 — CID 54276959
3-methyl-7-(5-phenoxypentyl)purine-2,6-dione (PubChem CID 54276959) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-methyl-7-(5-phenoxypentyl)purine-2,6-dione.
| Compound Name | 3-methyl-7-(5-phenoxypentyl)purine-2,6-dione |
|---|---|
| PubChem CID | 54276959 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-methyl-7-(5-phenoxypentyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1ncn2CCCCCOc1ccccc1 |
| InChI | InChI=1S/C17H20N4O3/c1-20-15-14(16(22)19-17(20)23)21(12-18-15)10-6-3-7-11-24-13-8-4-2-5-9-13/h2,4-5,8-9,12H,3,6-7,10-11H2,1H3,(H,19,22,23) |
| InChIKey | ROBNXTZXNUKCGA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|