C14H13N5O3 — CID 7304333
2-(3-methyl-2,6-dioxopurin-7-yl)-N-phenylacetamide (PubChem CID 7304333) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(3-methyl-2,6-dioxopurin-7-yl)-N-phenylacetamide.
| Compound Name | 2-(3-methyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 7304333 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(3-methyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1ncn2CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H13N5O3/c1-18-12-11(13(21)17-14(18)22)19(8-15-12)7-10(20)16-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,16,20)(H,17,21,22) |
| InChIKey | PBDWTGXAHHERGR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |