C14H25N6O5P — CID 137205977
2-[(2-amino-6-oxo-1H-purin-7-yl)methoxy]ethoxy-N,N-dipropylphosphonamidic acid (PubChem CID 137205977) has the molecular formula C14H25N6O5P and a molecular weight of 388.37 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-7-yl)methoxy]ethoxy-N,N-dipropylphosphonamidic acid.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-7-yl)methoxy]ethoxy-N,N-dipropylphosphonamidic acid |
|---|---|
| PubChem CID | 137205977 |
| Molecular Formula | C14H25N6O5P |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-7-yl)methoxy]ethoxy-N,N-dipropylphosphonamidic acid |
| SMILES | CCCN(CCC)P(=O)(O)OCCOCn1cnc2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H25N6O5P/c1-3-5-20(6-4-2)26(22,23)25-8-7-24-10-19-9-16-12-11(19)13(21)18-14(15)17-12/h9H,3-8,10H2,1-2H3,(H,22,23)(H3,15,17,18,21) |
| InChIKey | PCEQABOYGVEKCJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|