C11H16N5O5P — CID 135484438
[1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-2-methylcyclopropyl]oxymethylphosphonic acid (PubChem CID 135484438) has the molecular formula C11H16N5O5P and a molecular weight of 329.25 g/mol. Its IUPAC name is [1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-2-methylcyclopropyl]oxymethylphosphonic acid.
| Compound Name | [1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-2-methylcyclopropyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 135484438 |
| Molecular Formula | C11H16N5O5P |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-2-methylcyclopropyl]oxymethylphosphonic acid |
| SMILES | CC1CC1(Cn1cnc2c(=O)[nH]c(N)nc21)OCP(=O)(O)O |
| InChI | InChI=1S/C11H16N5O5P/c1-6-2-11(6,21-5-22(18,19)20)3-16-4-13-7-8(16)14-10(12)15-9(7)17/h4,6H,2-3,5H2,1H3,(H2,18,19,20)(H3,12,14,15,17) |
| InChIKey | RKNKYCUCLAWHLN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|