C26H23N5O5 — CID 135528120
[(1S,4R,6R)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-benzoyloxycyclohex-2-en-1-yl]methyl benzoate (PubChem CID 135528120) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is [(1S,4R,6R)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-benzoyloxycyclohex-2-en-1-yl]methyl benzoate.
| Compound Name | [(1S,4R,6R)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-benzoyloxycyclohex-2-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 135528120 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [(1S,4R,6R)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-benzoyloxycyclohex-2-en-1-yl]methyl benzoate |
| SMILES | Nc1nc2c(ncn2[C@H]2C=C[C@@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H23N5O5/c27-26-29-22-21(23(32)30-26)28-15-31(22)19-12-11-18(14-35-24(33)16-7-3-1-4-8-16)20(13-19)36-25(34)17-9-5-2-6-10-17/h1-12,15,18-20H,13-14H2,(H3,27,29,30,32)/t18-,19-,20+/m0/s1 |
| InChIKey | RKPZMENPJLEYQQ-SLFFLAALSA-N |
| XLogP | 2.90 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|