C21H27FN10O5 — CID 136603529
2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methanol (PubChem CID 136603529) has the molecular formula C21H27FN10O5 and a molecular weight of 518.51 g/mol. Its IUPAC name is 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methanol.
| Compound Name | 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 136603529 |
| Molecular Formula | C21H27FN10O5 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methanol |
| SMILES | Nc1nc2c(ncn2[C@@H]2C[C@H](CO)[C@H]2CO)c(=O)[nH]1.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C[C@@H]1F |
| InChI | InChI=1S/C11H15N5O3.C10H12FN5O2/c12-11-14-9-8(10(19)15-11)13-4-16(9)7-1-5(2-17)6(7)3-18;11-6-1-5(2-17)18-10(6)16-4-15-7-8(12)13-3-14-9(7)16/h4-7,17-18H,1-3H2,(H3,12,14,15,19);3-6,10,17H,1-2H2,(H2,12,13,14)/t5-,6-,7-;5-,6-,10+/m10/s1 |
| InChIKey | USUJISOOPIQXAX-BXZMYOTESA-N |
| XLogP | -1.11 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |