C12H16N5O3S- — CID 142535862
2-[(2R,3R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(hydroxymethyl)oxolan-3-yl]ethanethiolate (PubChem CID 142535862) has the molecular formula C12H16N5O3S- and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[(2R,3R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(hydroxymethyl)oxolan-3-yl]ethanethiolate.
| Compound Name | 2-[(2R,3R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(hydroxymethyl)oxolan-3-yl]ethanethiolate |
|---|---|
| PubChem CID | 142535862 |
| Molecular Formula | C12H16N5O3S- |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[(2R,3R,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-(hydroxymethyl)oxolan-3-yl]ethanethiolate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)C[C@@H]2CC[S-])c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O3S/c13-12-15-9-8(10(19)16-12)14-5-17(9)11-6(1-2-21)3-7(4-18)20-11/h5-7,11,18,21H,1-4H2,(H3,13,15,16,19)/p-1/t6-,7-,11+/m0/s1 |
| InChIKey | VAVCMQRYFKWTIG-OKTBNZSVSA-M |
| XLogP | -0.47 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|