C20H24FN10O9P — CID 149266210
[(2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-yl] [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 149266210) has the molecular formula C20H24FN10O9P and a molecular weight of 598.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-yl] [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-yl] [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 149266210 |
| Molecular Formula | C20H24FN10O9P |
| Molecular Weight | 598.45 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | [(2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-yl] [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](F)[C@H]2OP(=O)(O)OC[C@@H]2C[C@@H](O)[C@H](n3cnc4c(N)ncnc43)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H24FN10O9P/c21-10-9(2-32)39-19(31-6-27-12-16(31)28-20(23)29-17(12)34)13(10)40-41(35,36)37-3-7-1-8(33)18(38-7)30-5-26-11-14(22)24-4-25-15(11)30/h4-10,13,18-19,32-33H,1-3H2,(H,35,36)(H2,22,24,25)(H3,23,28,29,34)/t7-,8+,9+,10+,13+,18+,19+/m0/s1 |
| InChIKey | XQERKDMOJRULSC-KIEJEIKLSA-N |
| XLogP | -1.50 |
| TPSA | 273.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.45 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|