C39H37N5O11P2 — CID 89143547
[4-[[[[(1R,3S)-3-(2-aminopurin-9-yl)cyclopentyl]methoxy-hydroxyphosphoryl]oxy-[(4-benzoyloxyphenyl)methoxy]phosphoryl]oxymethyl]phenyl] benzoate (PubChem CID 89143547) has the molecular formula C39H37N5O11P2 and a molecular weight of 813.70 g/mol. Its IUPAC name is [4-[[[[(1R,3S)-3-(2-aminopurin-9-yl)cyclopentyl]methoxy-hydroxyphosphoryl]oxy-[(4-benzoyloxyphenyl)methoxy]phosphoryl]oxymethyl]phenyl] benzoate.
| Compound Name | [4-[[[[(1R,3S)-3-(2-aminopurin-9-yl)cyclopentyl]methoxy-hydroxyphosphoryl]oxy-[(4-benzoyloxyphenyl)methoxy]phosphoryl]oxymethyl]phenyl] benzoate |
|---|---|
| PubChem CID | 89143547 |
| Molecular Formula | C39H37N5O11P2 |
| Molecular Weight | 813.70 g/mol |
| Exact Mass | 813.20 |
| IUPAC Name | [4-[[[[(1R,3S)-3-(2-aminopurin-9-yl)cyclopentyl]methoxy-hydroxyphosphoryl]oxy-[(4-benzoyloxyphenyl)methoxy]phosphoryl]oxymethyl]phenyl] benzoate |
| SMILES | Nc1ncc2ncn([C@H]3CC[C@@H](COP(=O)(O)OP(=O)(OCc4ccc(OC(=O)c5ccccc5)cc4)OCc4ccc(OC(=O)c5ccccc5)cc4)C3)c2n1 |
| InChI | InChI=1S/C39H37N5O11P2/c40-39-41-22-35-36(43-39)44(26-42-35)32-16-11-29(21-32)25-50-56(47,48)55-57(49,51-23-27-12-17-33(18-13-27)53-37(45)30-7-3-1-4-8-30)52-24-28-14-19-34(20-15-28)54-38(46)31-9-5-2-6-10-31/h1-10,12-15,17-20,22,26,29,32H,11,16,21,23-25H2,(H,47,48)(H2,40,41,43)/t29-,32+/m1/s1 |
| InChIKey | YWLMNQRECMHVPT-PPTMTGTBSA-N |
| XLogP | 7.86 |
| TPSA | 213.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|