C29H23NO5 — CID 124722990
phenyl 4-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]benzoate (PubChem CID 124722990) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is phenyl 4-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]benzoate.
| Compound Name | phenyl 4-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 124722990 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | phenyl 4-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]benzoate |
| SMILES | O=C(Oc1ccccc1)c1ccc(COc2ccc(N3C(=O)[C@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C29H23NO5/c31-27-25-20-10-11-21(16-20)26(25)28(32)30(27)22-12-14-23(15-13-22)34-17-18-6-8-19(9-7-18)29(33)35-24-4-2-1-3-5-24/h1-15,20-21,25-26H,16-17H2/t20-,21-,25+,26+/m0/s1 |
| InChIKey | UAIZYGGGQIWUHD-KPOMPZIKSA-N |
| XLogP | 4.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|