C42H40N2O7 — CID 159240613
[4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoyl]phenyl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate;ethane (PubChem CID 159240613) has the molecular formula C42H40N2O7 and a molecular weight of 684.79 g/mol. Its IUPAC name is [4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoyl]phenyl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate;ethane.
| Compound Name | [4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoyl]phenyl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate;ethane |
|---|---|
| PubChem CID | 159240613 |
| Molecular Formula | C42H40N2O7 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | [4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoyl]phenyl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate;ethane |
| SMILES | CC.CC.O=C(Oc1ccc(C(=O)c2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)cc1)c1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C38H28N2O7.2C2H6/c41-33(19-5-11-26(12-6-19)39-34(42)29-22-1-2-23(17-22)30(29)35(39)43)20-9-15-28(16-10-20)47-38(46)21-7-13-27(14-8-21)40-36(44)31-24-3-4-25(18-24)32(31)37(40)45;2*1-2/h1-16,22-25,29-32H,17-18H2;2*1-2H3 |
| InChIKey | KUAVGUBBEYBFOP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|