C34H25NO7 — CID 58445027
[6-(4-methoxybenzoyl)oxynaphthalen-2-yl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate (PubChem CID 58445027) has the molecular formula C34H25NO7 and a molecular weight of 559.57 g/mol. Its IUPAC name is [6-(4-methoxybenzoyl)oxynaphthalen-2-yl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate.
| Compound Name | [6-(4-methoxybenzoyl)oxynaphthalen-2-yl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
|---|---|
| PubChem CID | 58445027 |
| Molecular Formula | C34H25NO7 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | [6-(4-methoxybenzoyl)oxynaphthalen-2-yl] 4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3cc(OC(=O)c4ccc(N5C(=O)C6C7C=CC(C7)C6C5=O)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C34H25NO7/c1-40-26-12-6-20(7-13-26)34(39)42-28-15-9-21-17-27(14-8-22(21)18-28)41-33(38)19-4-10-25(11-5-19)35-31(36)29-23-2-3-24(16-23)30(29)32(35)37/h2-15,17-18,23-24,29-30H,16H2,1H3 |
| InChIKey | QNUOCULSYIKPGQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|