C31H27NO4 — CID 98320500
[4-(2-phenylpropan-2-yl)phenyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 98320500) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98320500 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC(=O)c2ccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C31H27NO4/c1-31(2,22-6-4-3-5-7-22)23-12-16-25(17-13-23)36-30(35)19-10-14-24(15-11-19)32-28(33)26-20-8-9-21(18-20)27(26)29(32)34/h3-17,20-21,26-27H,18H2,1-2H3/t20-,21-,26-,27+/m0/s1 |
| InChIKey | XHDNGLYUAYLYOQ-LKSLQULUSA-N |
| XLogP | 5.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|