C32H29NO5 — CID 27276579
ethyl (2S)-2-[4-[[4-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]phenyl]-2-phenylacetate (PubChem CID 27276579) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[[4-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]phenyl]-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[4-[[4-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]phenyl]-2-phenylacetate |
|---|---|
| PubChem CID | 27276579 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | ethyl (2S)-2-[4-[[4-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]phenyl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccccc1)c1ccc(COc2ccc(N3C(=O)[C@@H]4[C@@H](C3=O)[C@H]3C=C[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C32H29NO5/c1-2-37-32(36)27(21-6-4-3-5-7-21)22-10-8-20(9-11-22)19-38-26-16-14-25(15-17-26)33-30(34)28-23-12-13-24(18-23)29(28)31(33)35/h3-17,23-24,27-29H,2,18-19H2,1H3/t23-,24+,27-,28-,29-/m0/s1 |
| InChIKey | GADFNLVCIGJNSE-BHBAPUPVSA-N |
| XLogP | 5.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|