C28H22N2O6 — CID 27110068
(1R,2S,6S,7S)-4-[4-[[4-(4-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 27110068) has the molecular formula C28H22N2O6 and a molecular weight of 482.49 g/mol. Its IUPAC name is (1R,2S,6S,7S)-4-[4-[[4-(4-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7S)-4-[4-[[4-(4-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 27110068 |
| Molecular Formula | C28H22N2O6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (1R,2S,6S,7S)-4-[4-[[4-(4-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(OCc3ccc(Oc4ccc([N+](=O)[O-])cc4)cc3)cc1)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C28H22N2O6/c31-27-25-18-3-4-19(15-18)26(25)28(32)29(27)20-5-11-22(12-6-20)35-16-17-1-9-23(10-2-17)36-24-13-7-21(8-14-24)30(33)34/h1-14,18-19,25-26H,15-16H2/t18-,19+,25-,26-/m0/s1 |
| InChIKey | GPVZYVBVGISIJK-ORSSICPCSA-N |
| XLogP | 5.28 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|