C28H21ClN2O6 — CID 51665667
(1R,2S,6R,7S)-4-[4-[[4-(2-chloro-6-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 51665667) has the molecular formula C28H21ClN2O6 and a molecular weight of 516.94 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[4-[[4-(2-chloro-6-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[4-[[4-(2-chloro-6-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 51665667 |
| Molecular Formula | C28H21ClN2O6 |
| Molecular Weight | 516.94 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (1R,2S,6R,7S)-4-[4-[[4-(2-chloro-6-nitrophenoxy)phenyl]methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(OCc3ccc(Oc4c(Cl)cccc4[N+](=O)[O-])cc3)cc1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C28H21ClN2O6/c29-22-2-1-3-23(31(34)35)26(22)37-21-10-4-16(5-11-21)15-36-20-12-8-19(9-13-20)30-27(32)24-17-6-7-18(14-17)25(24)28(30)33/h1-13,17-18,24-25H,14-15H2/t17-,18+,24-,25+ |
| InChIKey | WWDNHBZCYPEPSQ-HVXQOBHKSA-N |
| XLogP | 5.93 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|