C28H23ClN2O7 — CID 98105226
[4-(2-chloro-6-nitrophenoxy)phenyl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 98105226) has the molecular formula C28H23ClN2O7 and a molecular weight of 534.95 g/mol. Its IUPAC name is [4-(2-chloro-6-nitrophenoxy)phenyl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [4-(2-chloro-6-nitrophenoxy)phenyl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 98105226 |
| Molecular Formula | C28H23ClN2O7 |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | [4-(2-chloro-6-nitrophenoxy)phenyl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(OCc1ccc(Oc2c(Cl)cccc2[N+](=O)[O-])cc1)c1cccc(N2C(=O)[C@@H]3CCCC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C28H23ClN2O7/c29-23-9-4-10-24(31(35)36)25(23)38-20-13-11-17(12-14-20)16-37-28(34)18-5-3-6-19(15-18)30-26(32)21-7-1-2-8-22(21)27(30)33/h3-6,9-15,21-22H,1-2,7-8,16H2/t21-,22-/m1/s1 |
| InChIKey | LFIIYFNPEOPSCZ-FGZHOGPDSA-N |
| XLogP | 6.08 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|