C28H22Br2N2O7 — CID 126184897
[4-(4-nitrophenoxy)phenyl]methyl 4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 126184897) has the molecular formula C28H22Br2N2O7 and a molecular weight of 658.30 g/mol. Its IUPAC name is [4-(4-nitrophenoxy)phenyl]methyl 4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [4-(4-nitrophenoxy)phenyl]methyl 4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 126184897 |
| Molecular Formula | C28H22Br2N2O7 |
| Molecular Weight | 658.30 g/mol |
| Exact Mass | 655.98 |
| IUPAC Name | [4-(4-nitrophenoxy)phenyl]methyl 4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(OCc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)c1ccc(N2C(=O)[C@H]3C[C@H](Br)[C@@H](Br)C[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C28H22Br2N2O7/c29-24-13-22-23(14-25(24)30)27(34)31(26(22)33)18-5-3-17(4-6-18)28(35)38-15-16-1-9-20(10-2-16)39-21-11-7-19(8-12-21)32(36)37/h1-12,22-25H,13-15H2/t22-,23+,24-,25-/m0/s1 |
| InChIKey | HDCZMUACGPUOAX-NDBXHCKUSA-N |
| XLogP | 6.17 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.30 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|