C28H16Cl2N2O7 — CID 126177894
[3-(4-nitrophenoxy)phenyl]methyl 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126177894) has the molecular formula C28H16Cl2N2O7 and a molecular weight of 563.35 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126177894 |
| Molecular Formula | C28H16Cl2N2O7 |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(OCc1cccc(Oc2ccc([N+](=O)[O-])cc2)c1)c1ccc(N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C28H16Cl2N2O7/c29-24-13-22-23(14-25(24)30)27(34)31(26(22)33)18-6-4-17(5-7-18)28(35)38-15-16-2-1-3-21(12-16)39-20-10-8-19(9-11-20)32(36)37/h1-14H,15H2 |
| InChIKey | BBLSBSOOVBWWSE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|