C29H15Cl3N2O8 — CID 126186577
[2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126186577) has the molecular formula C29H15Cl3N2O8 and a molecular weight of 625.80 g/mol. Its IUPAC name is [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126186577 |
| Molecular Formula | C29H15Cl3N2O8 |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 623.99 |
| IUPAC Name | [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc1)c1ccc(Oc2c(Cl)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H15Cl3N2O8/c30-21-2-1-3-24(34(39)40)26(21)42-18-10-6-15(7-11-18)25(35)14-41-29(38)16-4-8-17(9-5-16)33-27(36)19-12-22(31)23(32)13-20(19)28(33)37/h1-13H,14H2 |
| InChIKey | WEIUKIINBZXAAC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|