C20H14Br2N2O5 — CID 126177867
[3-(4-nitrophenoxy)phenyl]methyl 4-amino-3,5-dibromobenzoate (PubChem CID 126177867) has the molecular formula C20H14Br2N2O5 and a molecular weight of 522.15 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 4-amino-3,5-dibromobenzoate.
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 4-amino-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 126177867 |
| Molecular Formula | C20H14Br2N2O5 |
| Molecular Weight | 522.15 g/mol |
| Exact Mass | 519.93 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 4-amino-3,5-dibromobenzoate |
| SMILES | Nc1c(Br)cc(C(=O)OCc2cccc(Oc3ccc([N+](=O)[O-])cc3)c2)cc1Br |
| InChI | InChI=1S/C20H14Br2N2O5/c21-17-9-13(10-18(22)19(17)23)20(25)28-11-12-2-1-3-16(8-12)29-15-6-4-14(5-7-15)24(26)27/h1-10H,11,23H2 |
| InChIKey | ALDCSXKZIJPWFV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.15 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|