About [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate
[3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate (PubChem CID 126187083) has the molecular formula C26H20N2O5
and a molecular weight of 440.46 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate.
Molecular Properties
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate |
| PubChem CID | 126187083 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate |
| SMILES | O=C(OCc1cccc(Oc2ccc([N+](=O)[O-])cc2)c1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C26H20N2O5/c29-26(24-11-4-5-12-25(24)27-20-8-2-1-3-9-20)32-18-19-7-6-10-23(17-19)33-22-15-13-21(14-16-22)28(30)31/h1-17,27H,18H2 |
| InChIKey | VVFFXJXHHOSDBJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate?
The IUPAC name of [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate (CID 126187083) is [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate.
What is the SMILES notation for [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate?
The canonical SMILES for [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate is O=C(OCc1cccc(Oc2ccc([N+](=O)[O-])cc2)c1)c1ccccc1Nc1ccccc1.
What is the InChIKey of [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate?
The InChIKey is VVFFXJXHHOSDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O5/c29-26(24-11-4-5-12-25(24)27-20-8-2-1-3-9-20)32-18-19-7-6-10-23(17-19)33-22-15-13-21(14-16-22)28(30)31/h1-17,27H,18H2.
What are the key properties of [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate?
[3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate has a molecular weight of 440.46 g/mol, XLogP of 6.49, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-nitrophenoxy)phenyl]methyl 2-anilinobenzoate is sourced from PubChem (CID 126187083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).