C19H21Br2NO4 — CID 11880308
butyl 4-[(3aS,5R,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 11880308) has the molecular formula C19H21Br2NO4 and a molecular weight of 487.19 g/mol. Its IUPAC name is butyl 4-[(3aS,5R,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | butyl 4-[(3aS,5R,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 11880308 |
| Molecular Formula | C19H21Br2NO4 |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | butyl 4-[(3aS,5R,6R,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)[C@H]3C[C@@H](Br)[C@H](Br)C[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C19H21Br2NO4/c1-2-3-8-26-19(25)11-4-6-12(7-5-11)22-17(23)13-9-15(20)16(21)10-14(13)18(22)24/h4-7,13-16H,2-3,8-10H2,1H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | ICBNAAWMGADQMZ-CAOSSQGBSA-N |
| XLogP | 4.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|