C21H23Br2NO4 — CID 124836712
pentyl 4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124836712) has the molecular formula C21H23Br2NO4 and a molecular weight of 513.23 g/mol. Its IUPAC name is pentyl 4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | pentyl 4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124836712 |
| Molecular Formula | C21H23Br2NO4 |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | pentyl 4-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H](Br)[C@H]4Br)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H23Br2NO4/c1-2-3-4-9-28-21(27)11-5-7-12(8-6-11)24-19(25)15-13-10-14(16(15)20(24)26)18(23)17(13)22/h5-8,13-18H,2-4,9-10H2,1H3/t13-,14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | GOSGOQGKGXYLID-KKFZBWNWSA-N |
| XLogP | 4.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|