C23H19Br2NO4 — CID 3119360
benzyl 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate (PubChem CID 3119360) has the molecular formula C23H19Br2NO4 and a molecular weight of 533.22 g/mol. Its IUPAC name is benzyl 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate.
| Compound Name | benzyl 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
|---|---|
| PubChem CID | 3119360 |
| Molecular Formula | C23H19Br2NO4 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | benzyl 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N2C(=O)C3C4CC(C(Br)C4Br)C3C2=O)cc1 |
| InChI | InChI=1S/C23H19Br2NO4/c24-19-15-10-16(20(19)25)18-17(15)21(27)26(22(18)28)14-8-6-13(7-9-14)23(29)30-11-12-4-2-1-3-5-12/h1-9,15-20H,10-11H2 |
| InChIKey | KBRXGPJHMJHCOO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|