C22H18BrNO4 — CID 1298064
(4-bromophenyl)methyl 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 1298064) has the molecular formula C22H18BrNO4 and a molecular weight of 440.29 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | (4-bromophenyl)methyl 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 1298064 |
| Molecular Formula | C22H18BrNO4 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (4-bromophenyl)methyl 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C(OCc1ccc(Br)cc1)c1ccc(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H18BrNO4/c23-16-9-5-14(6-10-16)13-28-22(27)15-7-11-17(12-8-15)24-20(25)18-3-1-2-4-19(18)21(24)26/h1-2,5-12,18-19H,3-4,13H2/t18-,19+ |
| InChIKey | GWDLNWLYRGHGEZ-KDURUIRLSA-N |
| XLogP | 4.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|