C23H18BrNO6 — CID 4210646
[2-(4-bromophenyl)-2-oxoethyl] 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-hydroxybenzoate (PubChem CID 4210646) has the molecular formula C23H18BrNO6 and a molecular weight of 484.30 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-hydroxybenzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 4210646 |
| Molecular Formula | C23H18BrNO6 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(N2C(=O)C3CC=CCC3C2=O)ccc1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrNO6/c24-14-7-5-13(6-8-14)20(27)12-31-23(30)18-11-15(9-10-19(18)26)25-21(28)16-3-1-2-4-17(16)22(25)29/h1-2,5-11,16-17,26H,3-4,12H2 |
| InChIKey | DLJDSLVXLNVOAU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|