C32H25NO8 — CID 1216817
diphenacyl 5-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,3-dicarboxylate (PubChem CID 1216817) has the molecular formula C32H25NO8 and a molecular weight of 551.55 g/mol. Its IUPAC name is diphenacyl 5-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | diphenacyl 5-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1216817 |
| Molecular Formula | C32H25NO8 |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | diphenacyl 5-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,3-dicarboxylate |
| SMILES | O=C(COC(=O)c1cc(C(=O)OCC(=O)c2ccccc2)cc(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C32H25NO8/c34-27(20-9-3-1-4-10-20)18-40-31(38)22-15-23(32(39)41-19-28(35)21-11-5-2-6-12-21)17-24(16-22)33-29(36)25-13-7-8-14-26(25)30(33)37/h1-12,15-17,25-26H,13-14,18-19H2/t25-,26+ |
| InChIKey | MZWZHMQKPYLPHY-WMPKNSHKSA-N |
| XLogP | 4.22 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|