C24H19NO6 — CID 3674280
phenacyl 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-hydroxybenzoate (PubChem CID 3674280) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is phenacyl 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-hydroxybenzoate.
| Compound Name | phenacyl 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 3674280 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | phenacyl 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(N2C(=O)C3C4C=CC(C4)C3C2=O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C24H19NO6/c26-18-9-8-16(25-22(28)20-14-6-7-15(10-14)21(20)23(25)29)11-17(18)24(30)31-12-19(27)13-4-2-1-3-5-13/h1-9,11,14-15,20-21,26H,10,12H2 |
| InChIKey | ICKPEIMXRUXSHO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|