C26H29NO4 — CID 19590685
(4-tert-butylphenyl)methyl 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 19590685) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | (4-tert-butylphenyl)methyl 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19590685 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (4-tert-butylphenyl)methyl 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | CC(C)(C)c1ccc(COC(=O)c2cccc(N3C(=O)C4CCCCC4C3=O)c2)cc1 |
| InChI | InChI=1S/C26H29NO4/c1-26(2,3)19-13-11-17(12-14-19)16-31-25(30)18-7-6-8-20(15-18)27-23(28)21-9-4-5-10-22(21)24(27)29/h6-8,11-15,21-22H,4-5,9-10,16H2,1-3H3 |
| InChIKey | RPMSVUMJKUKXQA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|