C28H29NO4 — CID 27234798
(4-tert-butylphenyl)methyl 4-[(1S,2R,6R,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 27234798) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 4-[(1S,2R,6R,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | (4-tert-butylphenyl)methyl 4-[(1S,2R,6R,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 27234798 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (4-tert-butylphenyl)methyl 4-[(1S,2R,6R,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CC1=C[C@@H]2C[C@H]1[C@H]1C(=O)N(c3ccc(C(=O)OCc4ccc(C(C)(C)C)cc4)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H29NO4/c1-16-13-19-14-22(16)24-23(19)25(30)29(26(24)31)21-11-7-18(8-12-21)27(32)33-15-17-5-9-20(10-6-17)28(2,3)4/h5-13,19,22-24H,14-15H2,1-4H3/t19-,22-,23-,24-/m1/s1 |
| InChIKey | SFPYDOIXKBOBNZ-OTUUDDROSA-N |
| XLogP | 5.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|