C24H20ClNO4 — CID 100808537
(2-chlorophenyl)methyl 4-[(1R,2S,6S,7R)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 100808537) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-[(1R,2S,6S,7R)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | (2-chlorophenyl)methyl 4-[(1R,2S,6S,7R)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 100808537 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (2-chlorophenyl)methyl 4-[(1R,2S,6S,7R)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CC1=C[C@H]2C[C@@H]1[C@@H]1C(=O)N(c3ccc(C(=O)OCc4ccccc4Cl)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H20ClNO4/c1-13-10-16-11-18(13)21-20(16)22(27)26(23(21)28)17-8-6-14(7-9-17)24(29)30-12-15-4-2-3-5-19(15)25/h2-10,16,18,20-21H,11-12H2,1H3/t16-,18-,20-,21-/m0/s1 |
| InChIKey | KDPLSXKNNFIETB-GIUOSPMZSA-N |
| XLogP | 4.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|