C22H18BrNO3 — CID 98150233
(1R,2R,6R,7S)-4-[4-(4-bromophenoxy)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98150233) has the molecular formula C22H18BrNO3 and a molecular weight of 424.29 g/mol. Its IUPAC name is (1R,2R,6R,7S)-4-[4-(4-bromophenoxy)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7S)-4-[4-(4-bromophenoxy)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98150233 |
| Molecular Formula | C22H18BrNO3 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (1R,2R,6R,7S)-4-[4-(4-bromophenoxy)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C[C@H]2C[C@H]1[C@H]1C(=O)N(c3ccc(Oc4ccc(Br)cc4)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C22H18BrNO3/c1-12-10-13-11-18(12)20-19(13)21(25)24(22(20)26)15-4-8-17(9-5-15)27-16-6-2-14(23)3-7-16/h2-10,13,18-20H,11H2,1H3/t13-,18+,19+,20+/m0/s1 |
| InChIKey | CZQMVJIXOKQYHH-BBLUDWJGSA-N |
| XLogP | 4.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|