C25H20FNO5 — CID 98279371
[2-(4-fluorophenyl)-2-oxoethyl] 3-[(1R,2R,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 98279371) has the molecular formula C25H20FNO5 and a molecular weight of 433.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-[(1R,2R,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(1R,2R,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98279371 |
| Molecular Formula | C25H20FNO5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(1R,2R,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CC1=C[C@H]2C[C@H]1[C@@H]1C(=O)N(c3cccc(C(=O)OCC(=O)c4ccc(F)cc4)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C25H20FNO5/c1-13-9-16-11-19(13)22-21(16)23(29)27(24(22)30)18-4-2-3-15(10-18)25(31)32-12-20(28)14-5-7-17(26)8-6-14/h2-10,16,19,21-22H,11-12H2,1H3/t16-,19+,21+,22-/m0/s1 |
| InChIKey | KVQGEDZVHYSDTR-MQYXYMALSA-N |
| XLogP | 3.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|