C23H21NO6 — CID 98213487
ethyl 5-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 98213487) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is ethyl 5-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 98213487 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | ethyl 5-[[4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(COc2ccc(N3C(=O)[C@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2)o1 |
| InChI | InChI=1S/C23H21NO6/c1-2-28-23(27)18-10-9-17(30-18)12-29-16-7-5-15(6-8-16)24-21(25)19-13-3-4-14(11-13)20(19)22(24)26/h3-10,13-14,19-20H,2,11-12H2,1H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | BXGYIWJXGMPZCM-AFHBHXEDSA-N |
| XLogP | 3.35 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|