C16H18O5 — CID 10017085
ethyl 5-[[4-(methoxymethyl)phenoxy]methyl]furan-2-carboxylate (PubChem CID 10017085) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 5-[[4-(methoxymethyl)phenoxy]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[4-(methoxymethyl)phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 10017085 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethyl 5-[[4-(methoxymethyl)phenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(COc2ccc(COC)cc2)o1 |
| InChI | InChI=1S/C16H18O5/c1-3-19-16(17)15-9-8-14(21-15)11-20-13-6-4-12(5-7-13)10-18-2/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | JGMQJBUHLODYFZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |