About 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one
5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one (PubChem CID 67779244) has the molecular formula C24H25N5O4
and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one.
Molecular Properties
| Compound Name | 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one |
| PubChem CID | 67779244 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one |
| SMILES | Nc1ncc2ncn(CCC(CO)(CO)CC(=O)c3ccc(Oc4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C24H25N5O4/c25-23-26-13-20-22(28-23)29(16-27-20)11-10-24(14-30,15-31)12-21(32)17-6-8-19(9-7-17)33-18-4-2-1-3-5-18/h1-9,13,16,30-31H,10-12,14-15H2,(H2,25,26,28) |
| InChIKey | FCSXUSKTRPMGSU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one?
The IUPAC name of 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one (CID 67779244) is 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one.
What is the SMILES notation for 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one?
The canonical SMILES for 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one is Nc1ncc2ncn(CCC(CO)(CO)CC(=O)c3ccc(Oc4ccccc4)cc3)c2n1.
What is the InChIKey of 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one?
The InChIKey is FCSXUSKTRPMGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5O4/c25-23-26-13-20-22(28-23)29(16-27-20)11-10-24(14-30,15-31)12-21(32)17-6-8-19(9-7-17)33-18-4-2-1-3-5-18/h1-9,13,16,30-31H,10-12,14-15H2,(H2,25,26,28).
What are the key properties of 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one?
5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one has a molecular weight of 447.50 g/mol, XLogP of 2.83, 10 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one is sourced from PubChem (CID 67779244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).