C24H25N5O4 — CID 67779244
5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one (PubChem CID 67779244) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one.
| Compound Name | 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 67779244 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-(2-aminopurin-9-yl)-3,3-bis(hydroxymethyl)-1-(4-phenoxyphenyl)pentan-1-one |
| SMILES | Nc1ncc2ncn(CCC(CO)(CO)CC(=O)c3ccc(Oc4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C24H25N5O4/c25-23-26-13-20-22(28-23)29(16-27-20)11-10-24(14-30,15-31)12-21(32)17-6-8-19(9-7-17)33-18-4-2-1-3-5-18/h1-9,13,16,30-31H,10-12,14-15H2,(H2,25,26,28) |
| InChIKey | FCSXUSKTRPMGSU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |