C17H19ClN5O5P — CID 67750038
[(1S,2S,3R)-3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (2-chlorophenyl) hydrogen phosphate (PubChem CID 67750038) has the molecular formula C17H19ClN5O5P and a molecular weight of 439.80 g/mol. Its IUPAC name is [(1S,2S,3R)-3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (2-chlorophenyl) hydrogen phosphate.
| Compound Name | [(1S,2S,3R)-3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (2-chlorophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 67750038 |
| Molecular Formula | C17H19ClN5O5P |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [(1S,2S,3R)-3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (2-chlorophenyl) hydrogen phosphate |
| SMILES | Nc1ncc2ncn([C@@H]3C[C@H](COP(=O)(O)Oc4ccccc4Cl)[C@@H]3CO)c2n1 |
| InChI | InChI=1S/C17H19ClN5O5P/c18-12-3-1-2-4-15(12)28-29(25,26)27-8-10-5-14(11(10)7-24)23-9-21-13-6-20-17(19)22-16(13)23/h1-4,6,9-11,14,24H,5,7-8H2,(H,25,26)(H2,19,20,22)/t10-,11+,14-/m1/s1 |
| InChIKey | AQLSQXHXWGKANM-UHIISALHSA-N |
| XLogP | 2.43 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|