About [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate
[2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate (PubChem CID 19018867) has the molecular formula C17H19FN5O5P
and a molecular weight of 423.34 g/mol. Its IUPAC name is [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate.
Molecular Properties
| Compound Name | [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate |
| PubChem CID | 19018867 |
| Molecular Formula | C17H19FN5O5P |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate |
| SMILES | Nc1ncc2ncn(C3CC(CO)C3COP(=O)(O)Oc3cccc(F)c3)c2n1 |
| InChI | InChI=1S/C17H19FN5O5P/c18-11-2-1-3-12(5-11)28-29(25,26)27-8-13-10(7-24)4-15(13)23-9-21-14-6-20-17(19)22-16(14)23/h1-3,5-6,9-10,13,15,24H,4,7-8H2,(H,25,26)(H2,19,20,22) |
| InChIKey | QTKFSEGGZUKHKA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate?
The IUPAC name of [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate (CID 19018867) is [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate.
What is the SMILES notation for [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate?
The canonical SMILES for [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate is Nc1ncc2ncn(C3CC(CO)C3COP(=O)(O)Oc3cccc(F)c3)c2n1.
What is the InChIKey of [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate?
The InChIKey is QTKFSEGGZUKHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN5O5P/c18-11-2-1-3-12(5-11)28-29(25,26)27-8-13-10(7-24)4-15(13)23-9-21-14-6-20-17(19)22-16(14)23/h1-3,5-6,9-10,13,15,24H,4,7-8H2,(H,25,26)(H2,19,20,22).
What are the key properties of [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate?
[2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate has a molecular weight of 423.34 g/mol, XLogP of 1.91, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-aminopurin-9-yl)-4-(hydroxymethyl)cyclobutyl]methyl (3-fluorophenyl) hydrogen phosphate is sourced from PubChem (CID 19018867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).