C9H15N6O4P — CID 153469313
[(2R)-4-(2,6-diaminopurin-9-yl)-2-hydroxybutyl]phosphonic acid (PubChem CID 153469313) has the molecular formula C9H15N6O4P and a molecular weight of 302.23 g/mol. Its IUPAC name is [(2R)-4-(2,6-diaminopurin-9-yl)-2-hydroxybutyl]phosphonic acid.
| Compound Name | [(2R)-4-(2,6-diaminopurin-9-yl)-2-hydroxybutyl]phosphonic acid |
|---|---|
| PubChem CID | 153469313 |
| Molecular Formula | C9H15N6O4P |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2R)-4-(2,6-diaminopurin-9-yl)-2-hydroxybutyl]phosphonic acid |
| SMILES | Nc1nc(N)c2ncn(CC[C@@H](O)CP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C9H15N6O4P/c10-7-6-8(14-9(11)13-7)15(4-12-6)2-1-5(16)3-20(17,18)19/h4-5,16H,1-3H2,(H2,17,18,19)(H4,10,11,13,14)/t5-/m1/s1 |
| InChIKey | JJDRVLIKUMIJFA-RXMQYKEDSA-N |
| XLogP | -1.08 |
| TPSA | 173.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|