C11H16F3N6O4P — CID 70272477
[2-[2-(2,6-diaminopurin-9-yl)ethoxy]-4,4,4-trifluorobutan-2-yl]phosphonic acid (PubChem CID 70272477) has the molecular formula C11H16F3N6O4P and a molecular weight of 384.26 g/mol. Its IUPAC name is [2-[2-(2,6-diaminopurin-9-yl)ethoxy]-4,4,4-trifluorobutan-2-yl]phosphonic acid.
| Compound Name | [2-[2-(2,6-diaminopurin-9-yl)ethoxy]-4,4,4-trifluorobutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 70272477 |
| Molecular Formula | C11H16F3N6O4P |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-[2-(2,6-diaminopurin-9-yl)ethoxy]-4,4,4-trifluorobutan-2-yl]phosphonic acid |
| SMILES | CC(CC(F)(F)F)(OCCn1cnc2c(N)nc(N)nc21)P(=O)(O)O |
| InChI | InChI=1S/C11H16F3N6O4P/c1-10(25(21,22)23,4-11(12,13)14)24-3-2-20-5-17-6-7(15)18-9(16)19-8(6)20/h5H,2-4H2,1H3,(H2,21,22,23)(H4,15,16,18,19) |
| InChIKey | RYKRIXKQOVDUNT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|