C18H19F6N6O4P — CID 21253161
[3-[2-(2-amino-6-anilinopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid (PubChem CID 21253161) has the molecular formula C18H19F6N6O4P and a molecular weight of 528.35 g/mol. Its IUPAC name is [3-[2-(2-amino-6-anilinopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid.
| Compound Name | [3-[2-(2-amino-6-anilinopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 21253161 |
| Molecular Formula | C18H19F6N6O4P |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | [3-[2-(2-amino-6-anilinopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
| SMILES | Nc1nc(Nc2ccccc2)c2ncn(CCOC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O)c2n1 |
| InChI | InChI=1S/C18H19F6N6O4P/c19-17(20,21)8-16(35(31,32)33,9-18(22,23)24)34-7-6-30-10-26-12-13(28-15(25)29-14(12)30)27-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2,31,32,33)(H3,25,27,28,29) |
| InChIKey | YOPWHZBHEAROEG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|