C11H15N6O4P — CID 5271678
2-[2-amino-6-(prop-2-ynylamino)purin-9-yl]ethoxymethylphosphonic acid (PubChem CID 5271678) has the molecular formula C11H15N6O4P and a molecular weight of 326.25 g/mol. Its IUPAC name is 2-[2-amino-6-(prop-2-ynylamino)purin-9-yl]ethoxymethylphosphonic acid.
| Compound Name | 2-[2-amino-6-(prop-2-ynylamino)purin-9-yl]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 5271678 |
| Molecular Formula | C11H15N6O4P |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[2-amino-6-(prop-2-ynylamino)purin-9-yl]ethoxymethylphosphonic acid |
| SMILES | C#CCNc1nc(N)nc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C11H15N6O4P/c1-2-3-13-9-8-10(16-11(12)15-9)17(6-14-8)4-5-21-7-22(18,19)20/h1,6H,3-5,7H2,(H2,18,19,20)(H3,12,13,15,16) |
| InChIKey | YCXSWGHBLJGPFE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|